cas: 914347-01-6 — see every product listed under this CAS number, including other names
Methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate, 98%, 98% (CAS 914347-01-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H13C-250mg |
| cas | 914347-01-6 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 554.00 Pln | |
| Chemat | 25g | 1283.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate (CAS 914347-01-6) is a chemical compound with the molecular formula C11H14BrN3O2 and a molecular weight of 300.15 g/mol. IUPAC name: methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate. InChIKey: CCUNQFMNCAFIEV-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O2 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate |
| InChIKey | CCUNQFMNCAFIEV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(CC1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)