cas: 914347-01-6 — see every product listed under this CAS number, including other names
Methyl 1-(5-Bromopyrimidin-2-yl)piperidine-4-carboxylate, 98.09% (CAS 914347-01-6) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 250 mg, 25 g, 5 g, 500 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W047436-10 g |
| cas | 914347-01-6 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 760.87 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 25 g | 1215.98 Pln | |
| MedChemExpress | 5 g | 575.11 Pln | |
| MedChemExpress | 500 mg | 287.18 Pln | |
| MedChemExpress | 1 g | 356.84 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.09% |
Methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate (CAS 914347-01-6) is a chemical compound with the molecular formula C11H14BrN3O2 and a molecular weight of 300.15 g/mol. IUPAC name: methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate. InChIKey: CCUNQFMNCAFIEV-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O2 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate |
| InChIKey | CCUNQFMNCAFIEV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(CC1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)