Methyl 1-ethylbenzotriazole-5-carboxylate, 98%
cas: 1393441-71-8 — see every product listed under this CAS number, including other names
Methyl 1-ethylbenzotriazole-5-carboxylate, 98% (CAS 1393441-71-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A476336-100mg |
| cas | 1393441-71-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 1610.81 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 626.00 Pln | |
| Chemat | 5g | 1614.80 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 303.25 Pln | |
| BLDpharm | 1g | 675.34 Pln | |
| BLDpharm | 5g | 1730.53 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 1-ethylbenzotriazole-5-carboxylate (CAS 1393441-71-8) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: methyl 1-ethylbenzotriazole-5-carboxylate. InChIKey: YNCHPTOPGIILEG-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | methyl 1-ethylbenzotriazole-5-carboxylate |
| InChIKey | YNCHPTOPGIILEG-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C(=O)OC)N=N1 |
Computed by PubChem (NCBI)