cas: 34213-34-8 — see every product listed under this CAS number, including other names
Methyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester, 98%, 98% (CAS 34213-34-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C0VK-1g |
| cas | 34213-34-8 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 25g | 424.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxane-2-carboxylate (CAS 34213-34-8) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxane-2-carboxylate. InChIKey: WQZLHCDEZYULJJ-ZXPJVPCYSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxane-2-carboxylate |
| InChIKey | WQZLHCDEZYULJJ-ZXPJVPCYSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)