CAS 34213-34-8 appears in our catalog under these names: Methyl 2,3,4-tri-o-acetyl-beta-d-glucuronic acid methyl ester, 95%, Methyl 2,3,4-Tri-O-acetyl-Beta-D-glucuronic Acid Methyl Ester, Methyl 2,3,4–Tri–O–acetyl–β–D–glucuronic acid methyl ester, Methyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester, Methyl 2,3,4-Tri-O-acetyl-b-D-glucuronic Acid Methyl Ester 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 25mg, 25g, 5g, 10mg, 5 g.
Methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxane-2-carboxylate (CAS 34213-34-8) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxane-2-carboxylate. InChIKey: WQZLHCDEZYULJJ-ZXPJVPCYSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxane-2-carboxylate |
| InChIKey | WQZLHCDEZYULJJ-ZXPJVPCYSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)