cas: 14920-88-8 — see every product listed under this CAS number, including other names
Methyl 2,4,6-tribromobenzoate, 98% (CAS 14920-88-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1480581-10g |
| cas | 14920-88-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12933.76 Pln | |
| AmBeed | 25g | 25374.37 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2,4,6-tribromobenzoate (CAS 14920-88-8) is a chemical compound with the molecular formula C8H5Br3O2 and a molecular weight of 372.84 g/mol. IUPAC name: methyl 2,4,6-tribromobenzoate. InChIKey: FCVBZWIVKMPUME-UHFFFAOYSA-N.
| Molecular formula | C8H5Br3O2 |
|---|---|
| Molecular weight | 372.84 g/mol |
| IUPAC name | methyl 2,4,6-tribromobenzoate |
| InChIKey | FCVBZWIVKMPUME-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Br)Br)Br |
Computed by PubChem (NCBI)