CAS 1820607-63-3 is the registry number for 4-(Bromomethyl)-3,5-dibromobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,5-dibromo-4-(bromomethyl)benzoic acid (CAS 1820607-63-3) is a chemical compound with the molecular formula C8H5Br3O2 and a molecular weight of 372.84 g/mol. IUPAC name: 3,5-dibromo-4-(bromomethyl)benzoic acid. InChIKey: YGUIGKFBULNEOB-UHFFFAOYSA-N.
| Molecular formula | C8H5Br3O2 |
|---|---|
| Molecular weight | 372.84 g/mol |
| IUPAC name | 3,5-dibromo-4-(bromomethyl)benzoic acid |
| InChIKey | YGUIGKFBULNEOB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)CBr)Br)C(=O)O |
Computed by PubChem (NCBI)