cas: 52047-13-9 — see every product listed under this CAS number, including other names
Methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate 97% (CAS 52047-13-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129689-100mg |
| cas | 52047-13-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1199.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A129689 |
Methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate (CAS 52047-13-9) is a chemical compound with the molecular formula C6H3Cl2N3O4 and a molecular weight of 252.01 g/mol. IUPAC name: methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate. InChIKey: QOZVZJLPNJOHFA-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3O4 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate |
| InChIKey | QOZVZJLPNJOHFA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)