CAS 52047-13-9 appears in our catalog under these names: Methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate, 95%, Methyl 2,6–Dichloro–5–nitropyrimidine–4–carboxylate, Methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate 97%, Methyl 2,6-Dichloro-5-nitropyrimidine-4-carboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
Methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate (CAS 52047-13-9) is a chemical compound with the molecular formula C6H3Cl2N3O4 and a molecular weight of 252.01 g/mol. IUPAC name: methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate. InChIKey: QOZVZJLPNJOHFA-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3O4 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | methyl 2,6-dichloro-5-nitropyrimidine-4-carboxylate |
| InChIKey | QOZVZJLPNJOHFA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)