cas: 2304634-26-0 — see every product listed under this CAS number, including other names
Methyl 2-(2-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-1(2H)-yl)acetate (CAS 2304634-26-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696552-250MG |
| cas | 2304634-26-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 2663.66 Pln | |
| Fluorochem | 1g | 5725.09 Pln | |
| Fluorochem | 5g | 12634.11 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2-[2-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-pyridinyl]acetate (CAS 2304634-26-0) is a chemical compound with the molecular formula C14H20BNO5 and a molecular weight of 293.13 g/mol. IUPAC name: methyl 2-[2-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-pyridinyl]acetate. InChIKey: MFDRADKJFUIVIV-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO5 |
|---|---|
| Molecular weight | 293.13 g/mol |
| IUPAC name | methyl 2-[2-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-pyridinyl]acetate |
| InChIKey | MFDRADKJFUIVIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C(=O)C=C2)CC(=O)OC |
Computed by PubChem (NCBI)