Products 1218791-20-8

CAS 1218791-20-8 is the registry number for 4-Ethoxy-3-nitrophenylboronic acid, pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(4-ethoxy-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1218791-20-8) is a chemical compound with the molecular formula C14H20BNO5 and a molecular weight of 293.13 g/mol. IUPAC name: 2-(4-ethoxy-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JDFWXCNRKPGZCO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20BNO5
Molecular weight293.13 g/mol
IUPAC name2-(4-ethoxy-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
InChIKeyJDFWXCNRKPGZCO-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OCC)[N+](=O)[O-]

Computed by PubChem (NCBI)