CAS 4724-10-1 appears in our catalog under these names: 3,5-Dihydroxyphenylacetic acid methyl ester, METHYL 3,5-DIHYDROXYPHENYLACETATE, 97%, Methyl 2-(3,5-dihydroxyphenyl)acetate, 97%, 97%. Offered by: Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 5g, 25g, 50g, 100g, 1G, 250mg.
Methyl 2-(3,5-dihydroxyphenyl)acetate (CAS 4724-10-1) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: methyl 2-(3,5-dihydroxyphenyl)acetate. InChIKey: LMLSBPHXMGSGCR-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | methyl 2-(3,5-dihydroxyphenyl)acetate |
| InChIKey | LMLSBPHXMGSGCR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC(=C1)O)O |
Computed by PubChem (NCBI)