cas: 873846-89-0 — see every product listed under this CAS number, including other names
Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate 98% (CAS 873846-89-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1379577-50mg |
| cas | 873846-89-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 209.06 Pln | |
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 804.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1379577 |
Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate (CAS 873846-89-0) is a chemical compound with the molecular formula C15H18BF3O4 and a molecular weight of 330.11 g/mol. IUPAC name: methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate. InChIKey: SIWNNYVLNBGRQK-UHFFFAOYSA-N.
| Molecular formula | C15H18BF3O4 |
|---|---|
| Molecular weight | 330.11 g/mol |
| IUPAC name | methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzoate |
| InChIKey | SIWNNYVLNBGRQK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)