cas: 57225-86-2 — see every product listed under this CAS number, including other names
Methyl 2-(4-chlorophenyl)-2-methylpropanoate (CAS 57225-86-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJA1-50mg |
| cas | 57225-86-2 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 131.60 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 500mg | 390.80 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 1619.60 Pln |
| delivery time | 3 weeks |
|---|
Methyl 2-(4-chlorophenyl)-2-methylpropanoate (CAS 57225-86-2) is a chemical compound with the molecular formula C11H13ClO2 and a molecular weight of 212.67 g/mol. IUPAC name: methyl 2-(4-chlorophenyl)-2-methylpropanoate. InChIKey: CDZJDEOJHDQJCR-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2 |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | methyl 2-(4-chlorophenyl)-2-methylpropanoate |
| InChIKey | CDZJDEOJHDQJCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)