cas: 1788894-41-6 — see every product listed under this CAS number, including other names
Methyl 2-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)acetate 98% (CAS 1788894-41-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A864551-100mg |
| cas | 1788894-41-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 4469.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A864551 |
Methyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]acetate (CAS 1788894-41-6) is a chemical compound with the molecular formula C13H19BO4S and a molecular weight of 282.2 g/mol. IUPAC name: methyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]acetate. InChIKey: NJSRIXQPXQLFGY-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4S |
|---|---|
| Molecular weight | 282.2 g/mol |
| IUPAC name | methyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]acetate |
| InChIKey | NJSRIXQPXQLFGY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CC(=O)OC |
Computed by PubChem (NCBI)