cas: 1788894-41-6 — see every product listed under this CAS number, including other names
Methyl 2-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)acetate, 95%, 95% (CAS 1788894-41-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1137GZ-100mg |
| cas | 1788894-41-6 |
| size | 100mg |
| availability | 6.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 500mg | 789.20 Pln | |
| Chemat | 1g | 1000.40 Pln | |
| Chemat | 5g | 3357.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]acetate (CAS 1788894-41-6) is a chemical compound with the molecular formula C13H19BO4S and a molecular weight of 282.2 g/mol. IUPAC name: methyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]acetate. InChIKey: NJSRIXQPXQLFGY-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4S |
|---|---|
| Molecular weight | 282.2 g/mol |
| IUPAC name | methyl 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]acetate |
| InChIKey | NJSRIXQPXQLFGY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CC(=O)OC |
Computed by PubChem (NCBI)