cas: 135325-18-7 — see every product listed under this CAS number, including other names
Methyl 2-[4-(trifluoromethyl)phenyl]acetate 98% (CAS 135325-18-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A294047-250mg |
| cas | 135325-18-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 531.69 Pln | |
| Ambeed | 25g | 1455.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A294047 |
Methyl 2-[4-(trifluoromethyl)phenyl]acetate (CAS 135325-18-7) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: methyl 2-[4-(trifluoromethyl)phenyl]acetate. InChIKey: ONNMKZXKTBYWFA-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | methyl 2-[4-(trifluoromethyl)phenyl]acetate |
| InChIKey | ONNMKZXKTBYWFA-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)