Methyl 2-Bromobenzoate, 98%, 98%
cas: 610-94-6 — see every product listed under this CAS number, including other names
Methyl 2-Bromobenzoate, 98%, 98% (CAS 610-94-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11466W-1g |
| cas | 610-94-6 |
| size | 1g |
| availability | 5000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 25g | 74.00 Pln | |
| Chemat | 100g | 83.60 Pln | |
| Chemat | 500g | 240.00 Pln | |
| Chemat | 1kg | 400.40 Pln | |
| Chemat | 5kg | 1939.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-bromobenzoate (CAS 610-94-6) is a chemical compound with the molecular formula C8H7BrO2 and a molecular weight of 215.04 g/mol. IUPAC name: methyl 2-bromobenzoate. InChIKey: SWGQITQOBPXVRC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO2 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | methyl 2-bromobenzoate |
| InChIKey | SWGQITQOBPXVRC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)
Synonyms:
Methyl-2-bromobenzoate, Benzoic acid, 2-bromo-, methyl ester, o-Bromobenzoic acid, methyl ester, Methyl obromobenzoate, Benzoic acid, obromo, methyl ester, Benzoic acid, 2bromo, methyl ester, Benzoic acid, obromo, methyl ester (8CI), InChI=1/C8H7BrO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H, SWGQITQOBPXVRC-UHFFFAOYSA-N, Methyl o-bromobenzoate