CAS 1093746-36-1 is the registry number for Methyl 2-Bromobenzoate-3,4,5,6-d4. Offered by: TRC. Available pack sizes: 100mg.
Methyl 2-bromo-3,4,5,6-tetradeuteriobenzoate (CAS 1093746-36-1) is a chemical compound with the molecular formula C8H7BrO2 and a molecular weight of 219.07 g/mol. IUPAC name: methyl 2-bromo-3,4,5,6-tetradeuteriobenzoate. InChIKey: SWGQITQOBPXVRC-QFFDRWTDSA-N.
| Molecular formula | C8H7BrO2 |
|---|---|
| Molecular weight | 219.07 g/mol |
| IUPAC name | methyl 2-bromo-3,4,5,6-tetradeuteriobenzoate |
| InChIKey | SWGQITQOBPXVRC-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OC)Br)[2H])[2H] |
Computed by PubChem (NCBI)