Methyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside
cas: 6619-04-1 — see every product listed under this CAS number, including other names
Methyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside (CAS 6619-04-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM79800C-10g |
| cas | 6619-04-1 |
| size | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 9048.95 Pln | |
| Chemat | 1g | 1929.08 Pln | |
| Chemat | 2g | 2867.74 Pln | |
| Chemat | 5g | 5390.09 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
N-(8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl)acetamide (CAS 6619-04-1) is a chemical compound with the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. IUPAC name: N-(8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl)acetamide. InChIKey: XCDVOAZVARITEI-UHFFFAOYSA-N.
| Molecular formula | C16H21NO6 |
|---|---|
| Molecular weight | 323.34 g/mol |
| IUPAC name | N-(8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl)acetamide |
| InChIKey | XCDVOAZVARITEI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(C2C(COC(O2)C3=CC=CC=C3)OC1OC)O |
Computed by PubChem (NCBI)