CAS 5545-52-8 appears in our catalog under these names: Z–Asp(OtBu)–OH·H2O, Z–Asp(OtBu)–OH, Z-L-Asp(OtBu)-OH*H2O, N-Benzyloxycarbonyl-L-aspartic acid 4-tert-butyl ester, 98% , Z-Asp(OtBu)-OH, >98.0%(HPLC)(T). Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100g, 500g, 25g, 5g, 1g, 1000g, 1kg, 10g.
(2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 5545-52-8) is a chemical compound with the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: HLSLRFBLVZUVIE-LBPRGKRZSA-N.
| Molecular formula | C16H21NO6 |
|---|---|
| Molecular weight | 323.34 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | HLSLRFBLVZUVIE-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)