cas: 101080-26-6 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-bromo-3-chlorobenzoate, 98% (CAS 101080-26-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F741383-250MG |
| cas | 101080-26-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1132.95 Pln | |
| Fluorochem | 1g | 2372.10 Pln | |
| Fluorochem | 5g | 6724.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-amino-5-bromo-3-chlorobenzoate (CAS 101080-26-6) is a chemical compound with the molecular formula C8H7BrClNO2 and a molecular weight of 264.50 g/mol. IUPAC name: methyl 2-amino-5-bromo-3-chlorobenzoate. InChIKey: NCNUYVGCMZFUFO-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO2 |
|---|---|
| Molecular weight | 264.50 g/mol |
| IUPAC name | methyl 2-amino-5-bromo-3-chlorobenzoate |
| InChIKey | NCNUYVGCMZFUFO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Br)Cl)N |
Computed by PubChem (NCBI)