cas: 1805503-91-6 — see every product listed under this CAS number, including other names
Methyl 2-bromo-5-fluoro-4-nitrobenzoate 98% (CAS 1805503-91-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1179584-100mg |
| cas | 1805503-91-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 782.00 Pln | |
| Ambeed | 5g | 2556.44 Pln | |
| Ambeed | 10g | 4547.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1179584 |
Methyl 2-bromo-5-fluoro-4-nitrobenzoate (CAS 1805503-91-6) is a chemical compound with the molecular formula C8H5BrFNO4 and a molecular weight of 278.03 g/mol. IUPAC name: methyl 2-bromo-5-fluoro-4-nitrobenzoate. InChIKey: DIZICDGIOHMPPZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO4 |
|---|---|
| Molecular weight | 278.03 g/mol |
| IUPAC name | methyl 2-bromo-5-fluoro-4-nitrobenzoate |
| InChIKey | DIZICDGIOHMPPZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)