cas: 188187-03-3 — see every product listed under this CAS number, including other names
Methyl 2-bromomethyl-3-chlorobenzoate, 98% (CAS 188187-03-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079061-250MG |
| cas | 188187-03-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 830.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-(bromomethyl)-3-chlorobenzoate (CAS 188187-03-3) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: methyl 2-(bromomethyl)-3-chlorobenzoate. InChIKey: BZXFVKQUKUJTIM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-3-chlorobenzoate |
| InChIKey | BZXFVKQUKUJTIM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Cl)CBr |
Computed by PubChem (NCBI)