cas: 175137-27-6 — see every product listed under this CAS number, including other names
Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate 98% (CAS 175137-27-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A427266-250mg |
| cas | 175137-27-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 1076.81 Pln | |
| Ambeed | 10g | 1749.88 Pln | |
| Ambeed | 25g | 3429.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A427266 |
Methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate (CAS 175137-27-6) is a chemical compound with the molecular formula C7H4ClF3N2O2 and a molecular weight of 240.57 g/mol. IUPAC name: methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate. InChIKey: VLUBJYUOPNGBOQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N2O2 |
|---|---|
| Molecular weight | 240.57 g/mol |
| IUPAC name | methyl 2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| InChIKey | VLUBJYUOPNGBOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(N=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)