cas: 264927-53-9 — see every product listed under this CAS number, including other names
Methyl 2-chloro-4-fluoro-5-iodobenzoate 97% (CAS 264927-53-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A777951-250mg |
| cas | 264927-53-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A777951 |
Methyl 2-chloro-4-fluoro-5-iodobenzoate (CAS 264927-53-9) is a chemical compound with the molecular formula C8H5ClFIO2 and a molecular weight of 314.48 g/mol. IUPAC name: methyl 2-chloro-4-fluoro-5-iodobenzoate. InChIKey: BTRLZJYOHXVECK-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFIO2 |
|---|---|
| Molecular weight | 314.48 g/mol |
| IUPAC name | methyl 2-chloro-4-fluoro-5-iodobenzoate |
| InChIKey | BTRLZJYOHXVECK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)F)I |
Computed by PubChem (NCBI)