Products 2649788-91-8

CAS 2649788-91-8 is the registry number for 5-Chloro-2-fluoro-4-iodo-3-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-chloro-2-fluoro-4-iodo-3-methylbenzoic acid (CAS 2649788-91-8) is a chemical compound with the molecular formula C8H5ClFIO2 and a molecular weight of 314.48 g/mol. IUPAC name: 5-chloro-2-fluoro-4-iodo-3-methylbenzoic acid. InChIKey: AUBYVHBQKULJDU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClFIO2
Molecular weight314.48 g/mol
IUPAC name5-chloro-2-fluoro-4-iodo-3-methylbenzoic acid
InChIKeyAUBYVHBQKULJDU-UHFFFAOYSA-N
SMILESCC1=C(C(=CC(=C1I)Cl)C(=O)O)F

Computed by PubChem (NCBI)