Methyl 2-chloro-5-hydroxynicotinate, 98%
cas: 1256834-59-9 — see every product listed under this CAS number, including other names
Methyl 2-chloro-5-hydroxynicotinate, 98% (CAS 1256834-59-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A607146-250mg |
| cas | 1256834-59-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 809.81 Pln | |
| Ambeed | 1g | 1477.31 Pln | |
| Ambeed | 5g | 4303.06 Pln | |
| Ambeed | 10g | 7123.25 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1173.20 Pln | |
| Chemat | 5g | 3650.00 Pln | |
| BLDpharm | 100mg | 664.24 Pln | |
| BLDpharm | 250mg | 869.72 Pln | |
| BLDpharm | 1g | 1586.13 Pln | |
| BLDpharm | 5g | 4635.06 Pln | |
| BLDpharm | 10g | 7678.43 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-chloro-5-hydroxypyridine-3-carboxylate (CAS 1256834-59-9) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: methyl 2-chloro-5-hydroxypyridine-3-carboxylate. InChIKey: ZBTMUCZLAPHKSS-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | methyl 2-chloro-5-hydroxypyridine-3-carboxylate |
| InChIKey | ZBTMUCZLAPHKSS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)O)Cl |
Computed by PubChem (NCBI)