Methyl 2-hydroxy-3-isopropylbenzoate, 95%
cas: 52159-64-5 — see every product listed under this CAS number, including other names
Methyl 2-hydroxy-3-isopropylbenzoate, 95% (CAS 52159-64-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A290157-250mg |
| cas | 52159-64-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1833.31 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 580.93 Pln | |
| BLDpharm | 5g | 1969.33 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 1g | 1132.95 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-hydroxy-3-propan-2-ylbenzoate (CAS 52159-64-5) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: methyl 2-hydroxy-3-propan-2-ylbenzoate. InChIKey: TZJOTDHMGVBGRS-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | methyl 2-hydroxy-3-propan-2-ylbenzoate |
| InChIKey | TZJOTDHMGVBGRS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(=O)OC)O |
Computed by PubChem (NCBI)