cas: 33778-93-7 — see every product listed under this CAS number, including other names
Methyl 2-hydroxy-5-(1-hydroxy-2-((4-phenylbutan-2-yl)amino)ethyl)benzoate hydrochloride, 95%, 95% (CAS 33778-93-7) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch138H6R-5mg |
| cas | 33778-93-7 |
| size | 5mg |
| availability | 0.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 750.80 Pln | |
| Chemat | 10mg | 1096.40 Pln | |
| Chemat | 25mg | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-hydroxy-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzoate;hydrochloride (CAS 33778-93-7) is a chemical compound with the molecular formula C20H26ClNO4 and a molecular weight of 379.9 g/mol. IUPAC name: methyl 2-hydroxy-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzoate;hydrochloride. InChIKey: ICWTVSJZJXZZIS-UHFFFAOYSA-N.
| Molecular formula | C20H26ClNO4 |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | methyl 2-hydroxy-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzoate;hydrochloride |
| InChIKey | ICWTVSJZJXZZIS-UHFFFAOYSA-N |
| SMILES | CC(CCC1=CC=CC=C1)NCC(C2=CC(=C(C=C2)O)C(=O)OC)O.Cl |
Computed by PubChem (NCBI)