CAS 33778-93-7 appears in our catalog under these names: Labetalol EP Impurity B HCl (Mixture of Diastereomers), Labetalol EP Impurity B (as Hydrochloride), Methyl 2-hydroxy-5-(1-hydroxy-2-((4-phenylbutan-2-yl)amino)ethyl)benzoate hydrochloride, 95%, 95%. Offered by: Chemat Brand, Mikromol, Chemat. Available pack sizes: on request, 25mg, 5mg, 10mg.
Methyl 2-hydroxy-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzoate;hydrochloride (CAS 33778-93-7) is a chemical compound with the molecular formula C20H26ClNO4 and a molecular weight of 379.9 g/mol. IUPAC name: methyl 2-hydroxy-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzoate;hydrochloride. InChIKey: ICWTVSJZJXZZIS-UHFFFAOYSA-N.
| Molecular formula | C20H26ClNO4 |
|---|---|
| Molecular weight | 379.9 g/mol |
| IUPAC name | methyl 2-hydroxy-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzoate;hydrochloride |
| InChIKey | ICWTVSJZJXZZIS-UHFFFAOYSA-N |
| SMILES | CC(CCC1=CC=CC=C1)NCC(C2=CC(=C(C=C2)O)C(=O)OC)O.Cl |
Computed by PubChem (NCBI)