CAS 182250-68-6 appears in our catalog under these names: methyl 3,5-bis[(tert-butyldiphenylsilyl)oxy]benzoate, 95%, Methyl 3,5–bis((tert–butyldiphenylsilyl)oxy)benzoate, Methyl 3,5-Bis(tert-butyldiphenylsilyloxy)benzoate (ca. 20% in Toluene, ca. 0.28mol/L). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 1g, 5g, 25g.
Methyl 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]benzoate (CAS 182250-68-6) is a chemical compound with the molecular formula C40H44O4Si2 and a molecular weight of 644.9 g/mol. IUPAC name: methyl 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]benzoate. InChIKey: DGYIOKNASZQETF-UHFFFAOYSA-N.
| Molecular formula | C40H44O4Si2 |
|---|---|
| Molecular weight | 644.9 g/mol |
| IUPAC name | methyl 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]benzoate |
| InChIKey | DGYIOKNASZQETF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OC3=CC(=CC(=C3)C(=O)OC)O[Si](C4=CC=CC=C4)(C5=CC=CC=C5)C(C)(C)C |
Computed by PubChem (NCBI)