cas: 926625-05-0 — see every product listed under this CAS number, including other names
Methyl 3-(3-bromophenyl)-2,2-dimethylpropanoate, 95%, 95% (CAS 926625-05-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KKXO-100mg |
| cas | 926625-05-0 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 635.60 Pln | |
| Chemat | 10g | 1168.40 Pln | |
| Chemat | 25g | 2051.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(3-bromophenyl)-2,2-dimethylpropanoate (CAS 926625-05-0) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: methyl 3-(3-bromophenyl)-2,2-dimethylpropanoate. InChIKey: CLBQGIWZFJUYBJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | methyl 3-(3-bromophenyl)-2,2-dimethylpropanoate |
| InChIKey | CLBQGIWZFJUYBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC(=CC=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)