CAS 926625-05-0 appears in our catalog under these names: Methyl 3-(3-bromophenyl)-2,2-dimethylpropanoate, 95%, Methyl 3–(3–bromophenyl)–2,2–dimethylpropanoate, Methyl 3-(3-bromophenyl)-2,2-dimethylpropanoate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g.
Methyl 3-(3-bromophenyl)-2,2-dimethylpropanoate (CAS 926625-05-0) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: methyl 3-(3-bromophenyl)-2,2-dimethylpropanoate. InChIKey: CLBQGIWZFJUYBJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | methyl 3-(3-bromophenyl)-2,2-dimethylpropanoate |
| InChIKey | CLBQGIWZFJUYBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC(=CC=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)