cas: 1375064-50-8 — see every product listed under this CAS number, including other names
Methyl 3-Chloro-4-(1-pyrrolidinyl)benzoate, >97%, >97% (CAS 1375064-50-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124F9-250mg |
| cas | 1375064-50-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 2195.60 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-chloro-4-pyrrolidin-1-ylbenzoate (CAS 1375064-50-8) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: methyl 3-chloro-4-pyrrolidin-1-ylbenzoate. InChIKey: UZQJIFFWGPGZNG-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | methyl 3-chloro-4-pyrrolidin-1-ylbenzoate |
| InChIKey | UZQJIFFWGPGZNG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N2CCCC2)Cl |
Computed by PubChem (NCBI)