cas: 952182-30-8 — see every product listed under this CAS number, including other names
Methyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate, 95%, 95% (CAS 952182-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIU8-100mg |
| cas | 952182-30-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 779.60 Pln | |
| Chemat | 1g | 2003.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (CAS 952182-30-8) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate. InChIKey: FSYGBFGZKCJGCW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate |
| InChIKey | FSYGBFGZKCJGCW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(N1)C=CC=N2)Br |
Computed by PubChem (NCBI)