CAS 1092351-65-9 appears in our catalog under these names: 5-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid methyl ester, 98%, 5-Bromoimidazo[1,2-A]Pyridine-2-Carboxylic Acid Methyl Ester, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Methyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS 1092351-65-9) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: CKKPLEFSWHGVNO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | CKKPLEFSWHGVNO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C(=N1)C=CC=C2Br |
Computed by PubChem (NCBI)