cas: 1123171-93-6 — see every product listed under this CAS number, including other names
Methyl 3-bromo-5-fluoro-4-nitrobenzoate, 98% (CAS 1123171-93-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F339467-100MG |
| cas | 1123171-93-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 1794.18 Pln | |
| Fluorochem | 10g | 2939.61 Pln | |
| Fluorochem | 25g | 6381.10 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-bromo-5-fluoro-4-nitrobenzoate (CAS 1123171-93-6) is a chemical compound with the molecular formula C8H5BrFNO4 and a molecular weight of 278.03 g/mol. IUPAC name: methyl 3-bromo-5-fluoro-4-nitrobenzoate. InChIKey: VTKKLEVLDPUKPD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO4 |
|---|---|
| Molecular weight | 278.03 g/mol |
| IUPAC name | methyl 3-bromo-5-fluoro-4-nitrobenzoate |
| InChIKey | VTKKLEVLDPUKPD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)