cas: 560131-64-8 — see every product listed under this CAS number, including other names
Methyl 3-bromo-5-tert-butylbenzoate, 96%, 96% (CAS 560131-64-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DA9Q-100mg |
| cas | 560131-64-8 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 5g | 2838.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-5-tert-butylbenzoate (CAS 560131-64-8) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: methyl 3-bromo-5-tert-butylbenzoate. InChIKey: XKPPDPWHRHLELX-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | methyl 3-bromo-5-tert-butylbenzoate |
| InChIKey | XKPPDPWHRHLELX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)