cas: 2121777-23-7 — see every product listed under this CAS number, including other names
Methyl 3-chloro-5-fluoro-2-isopropoxybenzoate, 98% (CAS 2121777-23-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1708375-25g |
| cas | 2121777-23-7 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 45262.42 Pln | |
| AmBeed | 5g | 13610.80 Pln | |
| AmBeed | 10g | 23089.36 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-chloro-5-fluoro-2-propan-2-yloxybenzoate (CAS 2121777-23-7) is a chemical compound with the molecular formula C11H12ClFO3 and a molecular weight of 246.66 g/mol. IUPAC name: methyl 3-chloro-5-fluoro-2-propan-2-yloxybenzoate. InChIKey: ZJNRLJUNACRVEF-UHFFFAOYSA-N.
| Molecular formula | C11H12ClFO3 |
|---|---|
| Molecular weight | 246.66 g/mol |
| IUPAC name | methyl 3-chloro-5-fluoro-2-propan-2-yloxybenzoate |
| InChIKey | ZJNRLJUNACRVEF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Cl)F)C(=O)OC |
Computed by PubChem (NCBI)