CAS 2432848-72-9 is the registry number for Methyl 3-chloro-5-fluoro-4-isopropoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 3-chloro-5-fluoro-4-propan-2-yloxybenzoate (CAS 2432848-72-9) is a chemical compound with the molecular formula C11H12ClFO3 and a molecular weight of 246.66 g/mol. IUPAC name: methyl 3-chloro-5-fluoro-4-propan-2-yloxybenzoate. InChIKey: DIHCLZTZUFPBBX-UHFFFAOYSA-N.
| Molecular formula | C11H12ClFO3 |
|---|---|
| Molecular weight | 246.66 g/mol |
| IUPAC name | methyl 3-chloro-5-fluoro-4-propan-2-yloxybenzoate |
| InChIKey | DIHCLZTZUFPBBX-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Cl)C(=O)OC)F |
Computed by PubChem (NCBI)