cas: 957065-97-3 — see every product listed under this CAS number, including other names
Methyl 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate 98% (CAS 957065-97-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180222-250mg |
| cas | 957065-97-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 565.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A180222 |
Methyl 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 957065-97-3) is a chemical compound with the molecular formula C14H18BNO6 and a molecular weight of 307.11 g/mol. IUPAC name: methyl 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: WRGJIRHQRSVMFP-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO6 |
|---|---|
| Molecular weight | 307.11 g/mol |
| IUPAC name | methyl 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | WRGJIRHQRSVMFP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)