CAS 2377607-58-2 is the registry number for 3-(Acetyloxy)-4-nitrophenylboronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate (CAS 2377607-58-2) is a chemical compound with the molecular formula C14H18BNO6 and a molecular weight of 307.11 g/mol. IUPAC name: [2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate. InChIKey: YTZCOAREDQPFOM-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO6 |
|---|---|
| Molecular weight | 307.11 g/mol |
| IUPAC name | [2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
| InChIKey | YTZCOAREDQPFOM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)[N+](=O)[O-])OC(=O)C |
Computed by PubChem (NCBI)