cas: 395664-58-1 — see every product listed under this CAS number, including other names
Methyl 4,5-dibromo-3-fluorothiophene-2-carboxylate, 97% (CAS 395664-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608641-100MG |
| cas | 395664-58-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 820.56 Pln | |
| Fluorochem | 250mg | 1190.22 Pln | |
| Fluorochem | 500mg | 1788.97 Pln | |
| Fluorochem | 1g | 2700.11 Pln | |
| Fluorochem | 5g | 7838.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4,5-dibromo-3-fluorothiophene-2-carboxylate (CAS 395664-58-1) is a chemical compound with the molecular formula C6H3Br2FO2S and a molecular weight of 317.96 g/mol. IUPAC name: methyl 4,5-dibromo-3-fluorothiophene-2-carboxylate. InChIKey: CUZHIRPKCADYDJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2FO2S |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | methyl 4,5-dibromo-3-fluorothiophene-2-carboxylate |
| InChIKey | CUZHIRPKCADYDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(S1)Br)Br)F |
Computed by PubChem (NCBI)