CAS 1092278-47-1 is the registry number for 2,5-dibromobenzenesulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2,5-dibromobenzenesulfonyl fluoride (CAS 1092278-47-1) is a chemical compound with the molecular formula C6H3Br2FO2S and a molecular weight of 317.96 g/mol. IUPAC name: 2,5-dibromobenzenesulfonyl fluoride. InChIKey: RSDRPBUYUKBWGY-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2FO2S |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | 2,5-dibromobenzenesulfonyl fluoride |
| InChIKey | RSDRPBUYUKBWGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)F)Br |
Computed by PubChem (NCBI)