cas: 1158759-65-9 — see every product listed under this CAS number, including other names
Methyl 4-(((tert-butoxycarbonyl)amino)methyl)piperidine-4-carboxylate 95% (CAS 1158759-65-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A809739-100mg |
| cas | 1158759-65-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 481.62 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 1510.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A809739 |
Methyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]piperidine-4-carboxylate (CAS 1158759-65-9) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: methyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]piperidine-4-carboxylate. InChIKey: COSVYQJPWXOLFH-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | methyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]piperidine-4-carboxylate |
| InChIKey | COSVYQJPWXOLFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CCNCC1)C(=O)OC |
Computed by PubChem (NCBI)