cas: 943845-74-7 — see every product listed under this CAS number, including other names
Methyl 4-((tert-butoxycarbonyl)amino)bicyclo[2.2.2]octane-1-carboxylate, 98%, 98% (CAS 943845-74-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116XJ9-100mg |
| cas | 943845-74-7 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 500mg | 213.20 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 702.80 Pln | |
| Chemat | 10g | 1274.00 Pln | |
| Chemat | 25g | 2488.40 Pln | |
| Chemat | 100g | 7821.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[2.2.2]octane-1-carboxylate (CAS 943845-74-7) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[2.2.2]octane-1-carboxylate. InChIKey: HNIMISROTAIHSQ-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[2.2.2]octane-1-carboxylate |
| InChIKey | HNIMISROTAIHSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CCC(CC1)(CC2)C(=O)OC |
Computed by PubChem (NCBI)