Methyl 4-(benzyloxy)-3,5-dihydroxybenzoate, 95+%
cas: 91925-82-5 — see every product listed under this CAS number, including other names
Methyl 4-(benzyloxy)-3,5-dihydroxybenzoate, 95+% (CAS 91925-82-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A136371-100mg |
| cas | 91925-82-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1010.00 Pln | |
| BLDpharm | 100mg | 286.59 Pln | |
| BLDpharm | 250mg | 453.20 Pln | |
| BLDpharm | 1g | 1058.54 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 3,5-dihydroxy-4-phenylmethoxybenzoate (CAS 91925-82-5) is a chemical compound with the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. IUPAC name: methyl 3,5-dihydroxy-4-phenylmethoxybenzoate. InChIKey: HXUGADXSKBFNMU-UHFFFAOYSA-N.
| Molecular formula | C15H14O5 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | methyl 3,5-dihydroxy-4-phenylmethoxybenzoate |
| InChIKey | HXUGADXSKBFNMU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)