CAS 307549-54-8 is the registry number for [(7-Methyl-4-oxo-1,2,3,4-tetrahydrocyclopenta[c]chromen-9-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetic acid (CAS 307549-54-8) is a chemical compound with the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. IUPAC name: 2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetic acid. InChIKey: VCEAHEMKSWXOSU-UHFFFAOYSA-N.
| Molecular formula | C15H14O5 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | 2-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]acetic acid |
| InChIKey | VCEAHEMKSWXOSU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C(CCC3)C(=O)O2)C(=C1)OCC(=O)O |
Computed by PubChem (NCBI)