cas: 536974-86-4 — see every product listed under this CAS number, including other names
Methyl 4-(benzyloxy)-3-chlorobenzoate, 97% (CAS 536974-86-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A470356-10g |
| cas | 536974-86-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 36630.16 Pln | |
| AmBeed | 5g | 21566.02 Pln | |
| AmBeed | 25g | 71920.87 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-chloro-4-phenylmethoxybenzoate (CAS 536974-86-4) is a chemical compound with the molecular formula C15H13ClO3 and a molecular weight of 276.71 g/mol. IUPAC name: methyl 3-chloro-4-phenylmethoxybenzoate. InChIKey: UAIHIALOAKCGMZ-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO3 |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | methyl 3-chloro-4-phenylmethoxybenzoate |
| InChIKey | UAIHIALOAKCGMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)